Compound Q&A

What are the physical and chemical properties of Tetraphenyl Dipropyleneglycol Diphosphite (CAS: 80584-85-6)?

Answer

Tetraphenyl Dipropyleneglycol Diphosphite
Tetraphenyl Dipropyleneglycol Diphosphite (CAS: 80584-85-6) is a crystalline compound with a molecular weight of approximately 562.24 g/mol. It is sparingly soluble in water but highly soluble in organic solvents such as ethanol and acetone. Chemically, it is moderately reactive and can be used in various applications requiring phosphite esters.

About

CAS No 80584-85-6
English Name Tetraphenyl Dipropyleneglycol Diphosphite
Molecular Formula C30H32O7P2
Molecular Weight 566.5 g/mol
SMILES CC(COCC(C)OP(OC1=CC=CC=C1)OC2=CC=CC=C2)OP(OC3=CC=CC=C3)OC4=CC=CC=C4
InChIKey XZZWOTQMUOIIFX-UHFFFAOYSA-N
Last Updated: 2025-10-05 08:54

Related Q&A

Compound Q&A

How is Tetraphenyl Dipropyleneglycol Diphosphite (CAS: 80584-85-6) typically synthesized?

Tetraphenyl Dipropyleneglycol Diphosphite is typically synthesized through the esterification of dip...

Compound Q&A

What industries use Tetraphenyl Dipropyleneglycol Diphosphite (CAS: 80584-85-6)?

Tetraphenyl Dipropyleneglycol Diphosphite is widely used in the pharmaceutical, polymer, and semicon...

Compound Q&A

What precautions should be taken when handling Tetraphenyl Dipropyleneglycol Diphosphite (CAS: 80584-85-6)?

When handling Tetraphenyl Dipropyleneglycol Diphosphite (CAS: 80584-85-6), it is crucial to wear app...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...