Compound Q&A

What industries use 3-Fluoro-4-nitrobenzoic acid (CAS: 403-21-4)?

Answer

3-Fluoro-4-nitrobenzoic acid
3-Fluoro-4-nitrobenzoic acid (CAS: 403-21-4) is used in various industries including pharmaceuticals, where it serves as a precursor for drug synthesis; in the production of dyes and pigments; in the development of sensors and detectors; and in the synthesis of materials for electronic and photonic applications.

About

CAS No 403-21-4
English Name 3-Fluoro-4-nitrobenzoic acid
Molecular Formula C7H4FNO4
Molecular Weight 185.11 g/mol
SMILES C1=CC(=C(C=C1C(=O)O)F)[N+](=O)[O-]
InChIKey WVZBIQSKLXJFNX-UHFFFAOYSA-N
Last Updated: 2025-10-05 08:54

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3-Fluoro-4-nitrobenzoic acid (CAS: 403-21-4)?

3-Fluoro-4-nitrobenzoic acid is a white crystalline solid with a molecular weight of 219.06 g/mol. I...

Compound Q&A

How is 3-Fluoro-4-nitrobenzoic acid (CAS: 403-21-4) typically synthesized?

3-Fluoro-4-nitrobenzoic acid can be synthesized by nitration of 3-fluorobenzoic acid followed by est...

Compound Q&A

What precautions should be taken when handling 3-Fluoro-4-nitrobenzoic acid (CAS: 403-21-4)?

When handling 3-Fluoro-4-nitrobenzoic acid, proper personal protective equipment (PPE) such as glove...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...