Compound Q&A

How is 3-Fluoro-4-nitrobenzoic acid (CAS: 403-21-4) typically synthesized?

Answer

3-Fluoro-4-nitrobenzoic acid
3-Fluoro-4-nitrobenzoic acid can be synthesized by nitration of 3-fluorobenzoic acid followed by esterification. Commonly, 3-fluorobenzoic acid is mixed with nitric acid and sulfuric acid in an appropriate solvent for the nitration process. The product is then converted to the acid form by hydrolysis. This compound can also be prepared via other routes involving aromatic substitution reactions.

About

CAS No 403-21-4
English Name 3-Fluoro-4-nitrobenzoic acid
Molecular Formula C7H4FNO4
Molecular Weight 185.11 g/mol
SMILES C1=CC(=C(C=C1C(=O)O)F)[N+](=O)[O-]
InChIKey WVZBIQSKLXJFNX-UHFFFAOYSA-N
Last Updated: 2025-10-05 08:54

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3-Fluoro-4-nitrobenzoic acid (CAS: 403-21-4)?

3-Fluoro-4-nitrobenzoic acid is a white crystalline solid with a molecular weight of 219.06 g/mol. I...

Compound Q&A

What industries use 3-Fluoro-4-nitrobenzoic acid (CAS: 403-21-4)?

3-Fluoro-4-nitrobenzoic acid (CAS: 403-21-4) is used in various industries including pharmaceuticals...

Compound Q&A

What precautions should be taken when handling 3-Fluoro-4-nitrobenzoic acid (CAS: 403-21-4)?

When handling 3-Fluoro-4-nitrobenzoic acid, proper personal protective equipment (PPE) such as glove...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...