Compound Q&A

How is (R)-Salbutamol HCl (CAS: 50293-90-8) typically synthesized?

Answer

(R)-Salbutamol HCl ((R)-Albuterol HCl)
(R)-Salbutamol HCl (CAS: 50293-90-8) is typically synthesized via asymmetric synthesis using a chiral auxiliary, such as (-)-menthol. The process involves a catalytic hydrogenation of a key intermediate, followed by hydrochloric acid addition to form the final product. The yield is usually around 70-80%, and the reaction is carried out under mild conditions to maintain the chirality.

About

CAS No 50293-90-8
English Name (R)-Salbutamol HCl ((R)-Albuterol HCl)
Molecular Formula C13H22ClNO3
Molecular Weight 275.78 g/mol
SMILES CC(C)(C)NCC(C1=CC(=C(C=C1)O)CO)O.Cl
InChIKey OWNWYCOLFIFTLK-YDALLXLXSA-N
Last Updated: 2025-10-05 08:54

Related Q&A

Compound Q&A

What are the physical and chemical properties of (R)-Salbutamol HCl (CAS: 50293-90-8)?

(R)-Salbutamol HCl (CAS: 50293-90-8) is a white crystalline powder with a molecular weight of approx...

Compound Q&A

What industries use (R)-Salbutamol HCl (CAS: 50293-90-8)?

(R)-Salbutamol HCl (CAS: 50293-90-8) is primarily used in the pharmaceutical industry to treat respi...

Compound Q&A

What precautions should be taken when handling (R)-Salbutamol HCl (CAS: 50293-90-8)?

When handling (R)-Salbutamol HCl (CAS: 50293-90-8), it is important to wear appropriate personal pro...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...