Compound Q&A

How is (5alpha,17beta)-17-Hydroxyandrostan-3-one (CAS: 521-18-6) typically synthesized?

Answer

(5alpha,17beta)-17-Hydroxyandrostan-3-one
(5alpha,17beta)-17-Hydroxyandrostan-3-one is typically synthesized through a series of reactions starting from androst-4-ene. A common method involves the reduction of androst-4-ene to androstan-4-ol, followed by a keto-reduction to form the final product. This synthesis often employs lithium aluminum hydride (LAH) as a reducing agent, with careful control of reaction conditions to ensure high yield and selectivity.

About

CAS No 521-18-6
English Name (5alpha,17beta)-17-Hydroxyandrostan-3-one
Molecular Formula C19H30O2
Molecular Weight 290.45 g/mol
SMILES C[C@]12CCC(=O)C[C@@H]1CC[C@@H]3[C@@H]2CC[C@]4([C@H]3CC[C@@H]4O)C
InChIKey NVKAWKQGWWIWPM-ABEVXSGRSA-N
Last Updated: 2025-10-05 08:54

Related Q&A

Compound Q&A

What are the physical and chemical properties of (5alpha,17beta)-17-Hydroxyandrostan-3-one (CAS: 521-18-6)?

(5alpha,17beta)-17-Hydroxyandrostan-3-one is a white crystalline powder with a molecular weight of a...

Compound Q&A

What industries use (5alpha,17beta)-17-Hydroxyandrostan-3-one (CAS: 521-18-6)?

(5alpha,17beta)-17-Hydroxyandrostan-3-one is primarily used in the pharmaceutical industry for hormo...

Compound Q&A

What precautions should be taken when handling (5alpha,17beta)-17-Hydroxyandrostan-3-one (CAS: 521-18-6)?

When handling (5alpha,17beta)-17-Hydroxyandrostan-3-one, it is crucial to wear appropriate personal ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...