Compound Q&A

What are the physical and chemical properties of (5alpha,17beta)-17-Hydroxyandrostan-3-one (CAS: 521-18-6)?

Answer

(5alpha,17beta)-17-Hydroxyandrostan-3-one
(5alpha,17beta)-17-Hydroxyandrostan-3-one is a white crystalline powder with a molecular weight of approximately 282.43 g/mol. It is slightly soluble in water and more soluble in organic solvents like methanol and ethanol. This compound is known for its low reactivity under normal conditions but can undergo hydrolysis in the presence of strong acids or bases. It is commonly used in research and pharmaceutical applications due to its hormonal properties.

About

CAS No 521-18-6
English Name (5alpha,17beta)-17-Hydroxyandrostan-3-one
Molecular Formula C19H30O2
Molecular Weight 290.45 g/mol
SMILES C[C@]12CCC(=O)C[C@@H]1CC[C@@H]3[C@@H]2CC[C@]4([C@H]3CC[C@@H]4O)C
InChIKey NVKAWKQGWWIWPM-ABEVXSGRSA-N
Last Updated: 2025-10-05 08:54

Related Q&A

Compound Q&A

How is (5alpha,17beta)-17-Hydroxyandrostan-3-one (CAS: 521-18-6) typically synthesized?

(5alpha,17beta)-17-Hydroxyandrostan-3-one is typically synthesized through a series of reactions sta...

Compound Q&A

What industries use (5alpha,17beta)-17-Hydroxyandrostan-3-one (CAS: 521-18-6)?

(5alpha,17beta)-17-Hydroxyandrostan-3-one is primarily used in the pharmaceutical industry for hormo...

Compound Q&A

What precautions should be taken when handling (5alpha,17beta)-17-Hydroxyandrostan-3-one (CAS: 521-18-6)?

When handling (5alpha,17beta)-17-Hydroxyandrostan-3-one, it is crucial to wear appropriate personal ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...