Compound Q&A

What industries use Ammonium 5-(L-gamma-glutamylamino)-2-nitrobenzoate (CAS: 63699-78-5)?

Answer

Ammonium 5-(L-gamma-glutamylamino)-2-nitrobenzoate
Ammonium 5-(L-gamma-glutamylamino)-2-nitrobenzoate (CAS: 63699-78-5) is primarily used in the pharmaceutical industry for its role as an intermediate in the synthesis of various drugs. It may also find applications in the sensor and semiconductor industries due to its functional groups that can be used for specific chemical reactions.

About

CAS No 63699-78-5
English Name Ammonium 5-(L-gamma-glutamylamino)-2-nitrobenzoate
Molecular Formula C12H16N4O7
Molecular Weight 311.25 g/mol
SMILES O=C([O-])C1=CC(NC(CC[C@H](N)C(O)=O)=O)=CC=C1[N+]([O-])=O.[NH4+]
InChIKey GFABNNMTRVBLPZ-QRPNPIFTSA-N
Last Updated: 2025-10-05 08:54

Related Q&A

Compound Q&A

What are the physical and chemical properties of Ammonium 5-(L-gamma-glutamylamino)-2-nitrobenzoate (CAS: 63699-78-5)?

Ammonium 5-(L-gamma-glutamylamino)-2-nitrobenzoate (CAS: 63699-78-5) is a solid with a crystalline f...

Compound Q&A

How is Ammonium 5-(L-gamma-glutamylamino)-2-nitrobenzoate (CAS: 63699-78-5) typically synthesized?

Ammonium 5-(L-gamma-glutamylamino)-2-nitrobenzoate (CAS: 63699-78-5) can be synthesized via the coup...

Compound Q&A

What precautions should be taken when handling Ammonium 5-(L-gamma-glutamylamino)-2-nitrobenzoate (CAS: 63699-78-5)?

When handling Ammonium 5-(L-gamma-glutamylamino)-2-nitrobenzoate (CAS: 63699-78-5), it is recommende...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...