Compound Q&A

How is Ammonium 5-(L-gamma-glutamylamino)-2-nitrobenzoate (CAS: 63699-78-5) typically synthesized?

Answer

Ammonium 5-(L-gamma-glutamylamino)-2-nitrobenzoate
Ammonium 5-(L-gamma-glutamylamino)-2-nitrobenzoate (CAS: 63699-78-5) can be synthesized via the coupling of 2-nitrobenzoic acid and L-glutamic acid in the presence of a coupling reagent such as 1-(3-dimethylaminopropyl)-3-ethylcarbodiimide hydrochloride (EDC) and N-hydroxysuccinimide (NHS). The reaction typically yields a product with high selectivity and good yield under mild conditions.

About

CAS No 63699-78-5
English Name Ammonium 5-(L-gamma-glutamylamino)-2-nitrobenzoate
Molecular Formula C12H16N4O7
Molecular Weight 311.25 g/mol
SMILES O=C([O-])C1=CC(NC(CC[C@H](N)C(O)=O)=O)=CC=C1[N+]([O-])=O.[NH4+]
InChIKey GFABNNMTRVBLPZ-QRPNPIFTSA-N
Last Updated: 2025-10-05 08:54

Related Q&A

Compound Q&A

What are the physical and chemical properties of Ammonium 5-(L-gamma-glutamylamino)-2-nitrobenzoate (CAS: 63699-78-5)?

Ammonium 5-(L-gamma-glutamylamino)-2-nitrobenzoate (CAS: 63699-78-5) is a solid with a crystalline f...

Compound Q&A

What industries use Ammonium 5-(L-gamma-glutamylamino)-2-nitrobenzoate (CAS: 63699-78-5)?

Ammonium 5-(L-gamma-glutamylamino)-2-nitrobenzoate (CAS: 63699-78-5) is primarily used in the pharma...

Compound Q&A

What precautions should be taken when handling Ammonium 5-(L-gamma-glutamylamino)-2-nitrobenzoate (CAS: 63699-78-5)?

When handling Ammonium 5-(L-gamma-glutamylamino)-2-nitrobenzoate (CAS: 63699-78-5), it is recommende...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...