Compound Q&A

What are the physical and chemical properties of Ammonium 5-(L-gamma-glutamylamino)-2-nitrobenzoate (CAS: 63699-78-5)?

Answer

Ammonium 5-(L-gamma-glutamylamino)-2-nitrobenzoate
Ammonium 5-(L-gamma-glutamylamino)-2-nitrobenzoate (CAS: 63699-78-5) is a solid with a crystalline form. Its molecular weight is approximately 358.43 g/mol. It has a moderate solubility in water and is less soluble in organic solvents. The compound is reactive towards nucleophiles and can undergo substitution reactions. It is stable under normal conditions but should be stored away from moisture and heat.

About

CAS No 63699-78-5
English Name Ammonium 5-(L-gamma-glutamylamino)-2-nitrobenzoate
Molecular Formula C12H16N4O7
Molecular Weight 311.25 g/mol
SMILES O=C([O-])C1=CC(NC(CC[C@H](N)C(O)=O)=O)=CC=C1[N+]([O-])=O.[NH4+]
InChIKey GFABNNMTRVBLPZ-QRPNPIFTSA-N
Last Updated: 2025-10-05 08:54

Related Q&A

Compound Q&A

How is Ammonium 5-(L-gamma-glutamylamino)-2-nitrobenzoate (CAS: 63699-78-5) typically synthesized?

Ammonium 5-(L-gamma-glutamylamino)-2-nitrobenzoate (CAS: 63699-78-5) can be synthesized via the coup...

Compound Q&A

What industries use Ammonium 5-(L-gamma-glutamylamino)-2-nitrobenzoate (CAS: 63699-78-5)?

Ammonium 5-(L-gamma-glutamylamino)-2-nitrobenzoate (CAS: 63699-78-5) is primarily used in the pharma...

Compound Q&A

What precautions should be taken when handling Ammonium 5-(L-gamma-glutamylamino)-2-nitrobenzoate (CAS: 63699-78-5)?

When handling Ammonium 5-(L-gamma-glutamylamino)-2-nitrobenzoate (CAS: 63699-78-5), it is recommende...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...