Compound Q&A

What industries use 1-(3-Nitrophenyl)methanamine hydrochloride (CAS: 26177-43-5)?

Answer

1-(3-Nitrophenyl)methanamine hydrochloride (1:1)
1-(3-Nitrophenyl)methanamine hydrochloride (CAS: 26177-43-5) finds applications in the pharmaceutical industry, where it serves as an intermediate in the synthesis of certain drug compounds. It is also used in the production of sensors and semiconductors due to its unique chemical properties. Additionally, it can be utilized in polymer chemistry for specific functionalization purposes.

About

CAS No 26177-43-5
English Name 1-(3-Nitrophenyl)methanamine hydrochloride (1:1)
Molecular Formula C7H9ClN2O2
Molecular Weight 188.61 g/mol
SMILES C1=CC(=CC(=C1)[N+](=O)[O-])CN.Cl
InChIKey DLZXLCHQWOZGSE-UHFFFAOYSA-N
Last Updated: 2025-10-01 21:42

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1-(3-Nitrophenyl)methanamine hydrochloride (CAS: 26177-43-5)?

1-(3-Nitrophenyl)methanamine hydrochloride (CAS: 26177-43-5) is a crystalline compound with a molecu...

Compound Q&A

How is 1-(3-Nitrophenyl)methanamine hydrochloride (CAS: 26177-43-5) typically synthesized?

1-(3-Nitrophenyl)methanamine hydrochloride (CAS: 26177-43-5) is typically synthesized by reacting 3-...

Compound Q&A

What precautions should be taken when handling 1-(3-Nitrophenyl)methanamine hydrochloride (CAS: 26177-43-5)?

Proper handling of 1-(3-Nitrophenyl)methanamine hydrochloride (CAS: 26177-43-5) requires the use of ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...