Compound Q&A

What are the physical and chemical properties of 1-(3-Nitrophenyl)methanamine hydrochloride (CAS: 26177-43-5)?

Answer

1-(3-Nitrophenyl)methanamine hydrochloride (1:1)
1-(3-Nitrophenyl)methanamine hydrochloride (CAS: 26177-43-5) is a crystalline compound with a molecular weight of approximately 223.07 g/mol. It has a solubility of about 20 g/L in water at 25°C. The compound is moderately reactive, particularly towards basic conditions, and can undergo hydrolysis. It has a pKa of around 2.5, indicating a strong acidic nature due to the presence of the hydrochloride ion.

About

CAS No 26177-43-5
English Name 1-(3-Nitrophenyl)methanamine hydrochloride (1:1)
Molecular Formula C7H9ClN2O2
Molecular Weight 188.61 g/mol
SMILES C1=CC(=CC(=C1)[N+](=O)[O-])CN.Cl
InChIKey DLZXLCHQWOZGSE-UHFFFAOYSA-N
Last Updated: 2025-10-01 21:42

Related Q&A

Compound Q&A

How is 1-(3-Nitrophenyl)methanamine hydrochloride (CAS: 26177-43-5) typically synthesized?

1-(3-Nitrophenyl)methanamine hydrochloride (CAS: 26177-43-5) is typically synthesized by reacting 3-...

Compound Q&A

What industries use 1-(3-Nitrophenyl)methanamine hydrochloride (CAS: 26177-43-5)?

1-(3-Nitrophenyl)methanamine hydrochloride (CAS: 26177-43-5) finds applications in the pharmaceutica...

Compound Q&A

What precautions should be taken when handling 1-(3-Nitrophenyl)methanamine hydrochloride (CAS: 26177-43-5)?

Proper handling of 1-(3-Nitrophenyl)methanamine hydrochloride (CAS: 26177-43-5) requires the use of ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...