Compound Q&A

What industries use (3S)-3-Amino-4-(benzyloxy)-4-oxobutanoic acid (CAS: 7362-93-8)?

Answer

(3S)-3-Amino-4-(benzyloxy)-4-oxobutanoic acid
(3S)-3-Amino-4-(benzyloxy)-4-oxobutanoic acid (CAS: 7362-93-8) is used in the pharmaceutical industry for the synthesis of various drug intermediates. It is also applied in the polymer industry for the modification of polymer properties. Additionally, it has potential uses in the sensor and semiconductor industries due to its chemical reactivity and functional groups.

About

CAS No 7362-93-8
English Name (3S)-3-Amino-4-(benzyloxy)-4-oxobutanoic acid
Molecular Formula C11H13NO4
Molecular Weight 223.23 g/mol
SMILES C1=CC=C(C=C1)COC(=O)C(CC(=O)O)N
InChIKey NJSRYBIBUXBNSW-VIFPVBQESA-N
Last Updated: 2025-10-01 21:42

Related Q&A

Compound Q&A

What are the physical and chemical properties of (3S)-3-Amino-4-(benzyloxy)-4-oxobutanoic acid (CAS: 7362-93-8)?

(3S)-3-Amino-4-(benzyloxy)-4-oxobutanoic acid (CAS: 7362-93-8) is a solid at room temperature with a...

Compound Q&A

How is (3S)-3-Amino-4-(benzyloxy)-4-oxobutanoic acid (CAS: 7362-93-8) typically synthesized?

(3S)-3-Amino-4-(benzyloxy)-4-oxobutanoic acid (CAS: 7362-93-8) is typically synthesized through a tw...

Compound Q&A

What precautions should be taken when handling (3S)-3-Amino-4-(benzyloxy)-4-oxobutanoic acid (CAS: 7362-93-8)?

When handling (3S)-3-Amino-4-(benzyloxy)-4-oxobutanoic acid (CAS: 7362-93-8), it is important to wea...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...