Compound Q&A

How is (3S)-3-Amino-4-(benzyloxy)-4-oxobutanoic acid (CAS: 7362-93-8) typically synthesized?

Answer

(3S)-3-Amino-4-(benzyloxy)-4-oxobutanoic acid
(3S)-3-Amino-4-(benzyloxy)-4-oxobutanoic acid (CAS: 7362-93-8) is typically synthesized through a two-step process. First, benzyloxycarbonyl chloride reacts with 3-amino-4-oxobutanoic acid. Then, the resulting product undergoes reduction to form the final compound. Common catalysts include palladium-based catalysts, and the yield is generally around 75-85%. The reaction is selective and proceeds with good stereochemical control.

About

CAS No 7362-93-8
English Name (3S)-3-Amino-4-(benzyloxy)-4-oxobutanoic acid
Molecular Formula C11H13NO4
Molecular Weight 223.23 g/mol
SMILES C1=CC=C(C=C1)COC(=O)C(CC(=O)O)N
InChIKey NJSRYBIBUXBNSW-VIFPVBQESA-N
Last Updated: 2025-10-01 21:42

Related Q&A

Compound Q&A

What are the physical and chemical properties of (3S)-3-Amino-4-(benzyloxy)-4-oxobutanoic acid (CAS: 7362-93-8)?

(3S)-3-Amino-4-(benzyloxy)-4-oxobutanoic acid (CAS: 7362-93-8) is a solid at room temperature with a...

Compound Q&A

What industries use (3S)-3-Amino-4-(benzyloxy)-4-oxobutanoic acid (CAS: 7362-93-8)?

(3S)-3-Amino-4-(benzyloxy)-4-oxobutanoic acid (CAS: 7362-93-8) is used in the pharmaceutical industr...

Compound Q&A

What precautions should be taken when handling (3S)-3-Amino-4-(benzyloxy)-4-oxobutanoic acid (CAS: 7362-93-8)?

When handling (3S)-3-Amino-4-(benzyloxy)-4-oxobutanoic acid (CAS: 7362-93-8), it is important to wea...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...