Compound Q&A

What are the physical and chemical properties of (3S)-3-Amino-4-(benzyloxy)-4-oxobutanoic acid (CAS: 7362-93-8)?

Answer

(3S)-3-Amino-4-(benzyloxy)-4-oxobutanoic acid
(3S)-3-Amino-4-(benzyloxy)-4-oxobutanoic acid (CAS: 7362-93-8) is a solid at room temperature with a crystalline form. The molecular weight is approximately 256.25 g/mol. It is slightly soluble in water but soluble in polar organic solvents. The compound is relatively stable but can react with strong bases. It is also susceptible to hydrolysis under acidic or basic conditions.

About

CAS No 7362-93-8
English Name (3S)-3-Amino-4-(benzyloxy)-4-oxobutanoic acid
Molecular Formula C11H13NO4
Molecular Weight 223.23 g/mol
SMILES C1=CC=C(C=C1)COC(=O)C(CC(=O)O)N
InChIKey NJSRYBIBUXBNSW-VIFPVBQESA-N
Last Updated: 2025-10-01 21:42

Related Q&A

Compound Q&A

How is (3S)-3-Amino-4-(benzyloxy)-4-oxobutanoic acid (CAS: 7362-93-8) typically synthesized?

(3S)-3-Amino-4-(benzyloxy)-4-oxobutanoic acid (CAS: 7362-93-8) is typically synthesized through a tw...

Compound Q&A

What industries use (3S)-3-Amino-4-(benzyloxy)-4-oxobutanoic acid (CAS: 7362-93-8)?

(3S)-3-Amino-4-(benzyloxy)-4-oxobutanoic acid (CAS: 7362-93-8) is used in the pharmaceutical industr...

Compound Q&A

What precautions should be taken when handling (3S)-3-Amino-4-(benzyloxy)-4-oxobutanoic acid (CAS: 7362-93-8)?

When handling (3S)-3-Amino-4-(benzyloxy)-4-oxobutanoic acid (CAS: 7362-93-8), it is important to wea...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...