Compound Q&A

What industries use 3-Hydroxy-5-[(E)-2-(4-methoxyphenyl)vinyl]phenyl beta-D-glucopyranoside (CAS: 30197-14-9)?

Answer

3-Hydroxy-5-[(E)-2-(4-methoxyphenyl)vinyl]phenyl beta-D-glucopyranoside
3-Hydroxy-5-[(E)-2-(4-methoxyphenyl)vinyl]phenyl beta-D-glucopyranoside is primarily used in the pharmaceutical industry as a potential drug candidate due to its unique chemical structure. It also has applications in the development of novel sensors and semiconductors due to its electronic properties. Additionally, it may find use in polymer research for modifying material properties.

About

CAS No 30197-14-9
English Name 3-Hydroxy-5-[(E)-2-(4-methoxyphenyl)vinyl]phenyl beta-D-glucopyranoside
Molecular Formula C21H24O8
Molecular Weight 404.42 g/mol
SMILES COC1=CC=C(C=C1)C=CC2=CC(=CC(=C2)OC3C(C(C(C(O3)CO)O)O)O)O
InChIKey MFMQRDLLSRLUJY-DXKBKAGUSA-N
Last Updated: 2025-10-01 21:42

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3-Hydroxy-5-[(E)-2-(4-methoxyphenyl)vinyl]phenyl beta-D-glucopyranoside (CAS: 30197-14-9)?

3-Hydroxy-5-[(E)-2-(4-methoxyphenyl)vinyl]phenyl beta-D-glucopyranoside is a white crystalline solid...

Compound Q&A

How is 3-Hydroxy-5-[(E)-2-(4-methoxyphenyl)vinyl]phenyl beta-D-glucopyranoside (CAS: 30197-14-9) typically synthesized?

3-Hydroxy-5-[(E)-2-(4-methoxyphenyl)vinyl]phenyl beta-D-glucopyranoside is typically synthesized via...

Compound Q&A

What precautions should be taken when handling 3-Hydroxy-5-[(E)-2-(4-methoxyphenyl)vinyl]phenyl beta-D-glucopyranoside (CAS: 30197-14-9)?

When handling 3-Hydroxy-5-[(E)-2-(4-methoxyphenyl)vinyl]phenyl beta-D-glucopyranoside (CAS: 30197-14...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...