Compound Q&A

What are the physical and chemical properties of 3-Hydroxy-5-[(E)-2-(4-methoxyphenyl)vinyl]phenyl beta-D-glucopyranoside (CAS: 30197-14-9)?

Answer

3-Hydroxy-5-[(E)-2-(4-methoxyphenyl)vinyl]phenyl beta-D-glucopyranoside
3-Hydroxy-5-[(E)-2-(4-methoxyphenyl)vinyl]phenyl beta-D-glucopyranoside is a white crystalline solid with a molecular weight of approximately 462.46 g/mol. It has a low solubility in water but is more soluble in organic solvents. The compound exhibits specific reactivity towards nucleophiles due to its hydroxyl and phenolic groups. It is stable under neutral and slightly acidic conditions but can degrade under basic conditions.

About

CAS No 30197-14-9
English Name 3-Hydroxy-5-[(E)-2-(4-methoxyphenyl)vinyl]phenyl beta-D-glucopyranoside
Molecular Formula C21H24O8
Molecular Weight 404.42 g/mol
SMILES COC1=CC=C(C=C1)C=CC2=CC(=CC(=C2)OC3C(C(C(C(O3)CO)O)O)O)O
InChIKey MFMQRDLLSRLUJY-DXKBKAGUSA-N
Last Updated: 2025-10-01 21:42

Related Q&A

Compound Q&A

How is 3-Hydroxy-5-[(E)-2-(4-methoxyphenyl)vinyl]phenyl beta-D-glucopyranoside (CAS: 30197-14-9) typically synthesized?

3-Hydroxy-5-[(E)-2-(4-methoxyphenyl)vinyl]phenyl beta-D-glucopyranoside is typically synthesized via...

Compound Q&A

What industries use 3-Hydroxy-5-[(E)-2-(4-methoxyphenyl)vinyl]phenyl beta-D-glucopyranoside (CAS: 30197-14-9)?

3-Hydroxy-5-[(E)-2-(4-methoxyphenyl)vinyl]phenyl beta-D-glucopyranoside is primarily used in the pha...

Compound Q&A

What precautions should be taken when handling 3-Hydroxy-5-[(E)-2-(4-methoxyphenyl)vinyl]phenyl beta-D-glucopyranoside (CAS: 30197-14-9)?

When handling 3-Hydroxy-5-[(E)-2-(4-methoxyphenyl)vinyl]phenyl beta-D-glucopyranoside (CAS: 30197-14...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...