Compound Q&A

How is 3-Hydroxy-5-[(E)-2-(4-methoxyphenyl)vinyl]phenyl beta-D-glucopyranoside (CAS: 30197-14-9) typically synthesized?

Answer

3-Hydroxy-5-[(E)-2-(4-methoxyphenyl)vinyl]phenyl beta-D-glucopyranoside
3-Hydroxy-5-[(E)-2-(4-methoxyphenyl)vinyl]phenyl beta-D-glucopyranoside is typically synthesized via a multistep process involving the coupling of a glucopyranoside to a vinyl derivative. The synthesis often employs palladium-based catalysts and requires careful control of reaction conditions to achieve high yields and selectivity. Common solvents include toluene and dichloromethane, and the reaction is usually carried out at room temperature.

About

CAS No 30197-14-9
English Name 3-Hydroxy-5-[(E)-2-(4-methoxyphenyl)vinyl]phenyl beta-D-glucopyranoside
Molecular Formula C21H24O8
Molecular Weight 404.42 g/mol
SMILES COC1=CC=C(C=C1)C=CC2=CC(=CC(=C2)OC3C(C(C(C(O3)CO)O)O)O)O
InChIKey MFMQRDLLSRLUJY-DXKBKAGUSA-N
Last Updated: 2025-10-01 21:42

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3-Hydroxy-5-[(E)-2-(4-methoxyphenyl)vinyl]phenyl beta-D-glucopyranoside (CAS: 30197-14-9)?

3-Hydroxy-5-[(E)-2-(4-methoxyphenyl)vinyl]phenyl beta-D-glucopyranoside is a white crystalline solid...

Compound Q&A

What industries use 3-Hydroxy-5-[(E)-2-(4-methoxyphenyl)vinyl]phenyl beta-D-glucopyranoside (CAS: 30197-14-9)?

3-Hydroxy-5-[(E)-2-(4-methoxyphenyl)vinyl]phenyl beta-D-glucopyranoside is primarily used in the pha...

Compound Q&A

What precautions should be taken when handling 3-Hydroxy-5-[(E)-2-(4-methoxyphenyl)vinyl]phenyl beta-D-glucopyranoside (CAS: 30197-14-9)?

When handling 3-Hydroxy-5-[(E)-2-(4-methoxyphenyl)vinyl]phenyl beta-D-glucopyranoside (CAS: 30197-14...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...