Compound Q&A

What industries use Zinc bis(hydrogen carbonate) (CAS: 5263-02-5)?

Answer

Zinc bis(hydrogen carbonate)
Zinc bis(hydrogen carbonate) is used in various industries, including pharmaceuticals, where it serves as a precursor for the synthesis of various zinc-containing compounds. It is also used in the production of polymers, sensors, and semiconductors. Additionally, it finds applications in the preparation of zinc-containing catalysts and as a stabilizer in the formulation of paints and pigments.

About

CAS No 5263-02-5
English Name Zinc bis(hydrogen carbonate)
Molecular Formula C2H2O6Zn
Molecular Weight 142.4 g/mol
EINECS 226-076-7
SMILES C(=O)(O)[O-].C(=O)(O)[O-].[Zn+2]
InChIKey PCHQDTOLHOFHHK-UHFFFAOYSA-L
Last Updated: 2025-10-01 21:42

Related Q&A

Compound Q&A

What are the physical and chemical properties of Zinc bis(hydrogen carbonate) (CAS: 5263-02-5)?

Zinc bis(hydrogen carbonate) is a white crystalline solid with a molecular weight of approximately 1...

Compound Q&A

How is Zinc bis(hydrogen carbonate) (CAS: 5263-02-5) typically synthesized?

Zinc bis(hydrogen carbonate) is typically synthesized by reacting zinc carbonate with a strong acid ...

Compound Q&A

What precautions should be taken when handling Zinc bis(hydrogen carbonate) (CAS: 5263-02-5)?

When handling Zinc bis(hydrogen carbonate), it is essential to wear appropriate personal protective ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...