Compound Q&A

How is Zinc bis(hydrogen carbonate) (CAS: 5263-02-5) typically synthesized?

Answer

Zinc bis(hydrogen carbonate)
Zinc bis(hydrogen carbonate) is typically synthesized by reacting zinc carbonate with a strong acid such as sulfuric acid or hydrochloric acid. The process involves a stepwise reaction where zinc carbonate is first converted to zinc sulfate or zinc chloride, followed by the formation of zinc bis(hydrogen carbonate) through the addition of water or carbon dioxide. The reaction is carried out under mild conditions, and the product is usually filtered and dried.

About

CAS No 5263-02-5
English Name Zinc bis(hydrogen carbonate)
Molecular Formula C2H2O6Zn
Molecular Weight 142.4 g/mol
EINECS 226-076-7
SMILES C(=O)(O)[O-].C(=O)(O)[O-].[Zn+2]
InChIKey PCHQDTOLHOFHHK-UHFFFAOYSA-L
Last Updated: 2025-10-01 21:42

Related Q&A

Compound Q&A

What are the physical and chemical properties of Zinc bis(hydrogen carbonate) (CAS: 5263-02-5)?

Zinc bis(hydrogen carbonate) is a white crystalline solid with a molecular weight of approximately 1...

Compound Q&A

What industries use Zinc bis(hydrogen carbonate) (CAS: 5263-02-5)?

Zinc bis(hydrogen carbonate) is used in various industries, including pharmaceuticals, where it serv...

Compound Q&A

What precautions should be taken when handling Zinc bis(hydrogen carbonate) (CAS: 5263-02-5)?

When handling Zinc bis(hydrogen carbonate), it is essential to wear appropriate personal protective ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...