Compound Q&A

What are the physical and chemical properties of Zinc bis(hydrogen carbonate) (CAS: 5263-02-5)?

Answer

Zinc bis(hydrogen carbonate)
Zinc bis(hydrogen carbonate) is a white crystalline solid with a molecular weight of approximately 113.42 g/mol. It is slightly soluble in water and exhibits basic properties due to the carbonate ions. This compound is less reactive under normal conditions but can decompose upon heating to form zinc oxide and carbon dioxide. It is commonly used as a precursor in various chemical reactions and as a source of zinc in industrial applications.

About

CAS No 5263-02-5
English Name Zinc bis(hydrogen carbonate)
Molecular Formula C2H2O6Zn
Molecular Weight 142.4 g/mol
EINECS 226-076-7
SMILES C(=O)(O)[O-].C(=O)(O)[O-].[Zn+2]
InChIKey PCHQDTOLHOFHHK-UHFFFAOYSA-L
Last Updated: 2025-10-01 21:42

Related Q&A

Compound Q&A

How is Zinc bis(hydrogen carbonate) (CAS: 5263-02-5) typically synthesized?

Zinc bis(hydrogen carbonate) is typically synthesized by reacting zinc carbonate with a strong acid ...

Compound Q&A

What industries use Zinc bis(hydrogen carbonate) (CAS: 5263-02-5)?

Zinc bis(hydrogen carbonate) is used in various industries, including pharmaceuticals, where it serv...

Compound Q&A

What precautions should be taken when handling Zinc bis(hydrogen carbonate) (CAS: 5263-02-5)?

When handling Zinc bis(hydrogen carbonate), it is essential to wear appropriate personal protective ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...