Compound Q&A

What precautions should be taken when handling 3-Methyl-1-octyl-1H-imidazol-3-ium hexafluorophosphate (CAS: 304680-36-2)?

Answer

3-Methyl-1-octyl-1H-imidazol-3-ium hexafluorophosphate
When handling 3-Methyl-1-octyl-1H-imidazol-3-ium hexafluorophosphate, it is essential to wear appropriate personal protective equipment (PPE) including gloves, safety goggles, and a lab coat. Ensure that the work is conducted in a well-ventilated area or a fume hood. Store the compound in a tightly sealed container away from moisture and heat sources. If a spill occurs, neutralize it with an appropriate base and dispose of according to local regulations. Always refer to the Safety Data Sheet (SDS) for detailed handling and disposal information.

About

English Name 3-Methyl-1-octyl-1H-imidazol-3-ium hexafluorophosphate
Molecular Formula C12H23F6N2P
Molecular Weight 340.29 g/mol
SMILES CCCCCCCCN1C=C[N+](=C1)C.F[P-](F)(F)(F)(F)F
InChIKey GRCIJNHHTXBJAK-UHFFFAOYSA-N
Last Updated: 2025-10-01 21:42

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3-Methyl-1-octyl-1H-imidazol-3-ium hexafluorophosphate (CAS: 304680-36-2)?

3-Methyl-1-octyl-1H-imidazol-3-ium hexafluorophosphate is a crystalline compound with a molecular we...

Compound Q&A

How is 3-Methyl-1-octyl-1H-imidazol-3-ium hexafluorophosphate (CAS: 304680-36-2) typically synthesized?

3-Methyl-1-octyl-1H-imidazol-3-ium hexafluorophosphate is synthesized through a multi-step process s...

Compound Q&A

What industries use 3-Methyl-1-octyl-1H-imidazol-3-ium hexafluorophosphate (CAS: 304680-36-2)?

3-Methyl-1-octyl-1H-imidazol-3-ium hexafluorophosphate finds applications in the pharmaceutical indu...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...