Compound Q&A

What are the physical and chemical properties of 3-Methyl-1-octyl-1H-imidazol-3-ium hexafluorophosphate (CAS: 304680-36-2)?

Answer

3-Methyl-1-octyl-1H-imidazol-3-ium hexafluorophosphate
3-Methyl-1-octyl-1H-imidazol-3-ium hexafluorophosphate is a crystalline compound with a molecular weight of approximately 364.7 g/mol. It has good solubility in organic solvents like dimethyl sulfoxide (DMSO) and poor solubility in water. The compound exhibits basic properties and can undergo proton transfer reactions. It is stable under normal conditions but should be handled under an inert atmosphere to prevent hydrolysis.

About

English Name 3-Methyl-1-octyl-1H-imidazol-3-ium hexafluorophosphate
Molecular Formula C12H23F6N2P
Molecular Weight 340.29 g/mol
SMILES CCCCCCCCN1C=C[N+](=C1)C.F[P-](F)(F)(F)(F)F
InChIKey GRCIJNHHTXBJAK-UHFFFAOYSA-N
Last Updated: 2025-10-01 21:42

Related Q&A

Compound Q&A

How is 3-Methyl-1-octyl-1H-imidazol-3-ium hexafluorophosphate (CAS: 304680-36-2) typically synthesized?

3-Methyl-1-octyl-1H-imidazol-3-ium hexafluorophosphate is synthesized through a multi-step process s...

Compound Q&A

What industries use 3-Methyl-1-octyl-1H-imidazol-3-ium hexafluorophosphate (CAS: 304680-36-2)?

3-Methyl-1-octyl-1H-imidazol-3-ium hexafluorophosphate finds applications in the pharmaceutical indu...

Compound Q&A

What precautions should be taken when handling 3-Methyl-1-octyl-1H-imidazol-3-ium hexafluorophosphate (CAS: 304680-36-2)?

When handling 3-Methyl-1-octyl-1H-imidazol-3-ium hexafluorophosphate, it is essential to wear approp...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...