Compound Q&A

What industries use 3-Methyl-1-octyl-1H-imidazol-3-ium hexafluorophosphate (CAS: 304680-36-2)?

Answer

3-Methyl-1-octyl-1H-imidazol-3-ium hexafluorophosphate
3-Methyl-1-octyl-1H-imidazol-3-ium hexafluorophosphate finds applications in the pharmaceutical industry as a precursor for developing proton conductive membranes. It is also used in the polymer industry for synthesizing conductive polymers. Additionally, it is utilized in sensor technologies for detecting specific gases and in semiconductor manufacturing for etching and cleaning processes.

About

English Name 3-Methyl-1-octyl-1H-imidazol-3-ium hexafluorophosphate
Molecular Formula C12H23F6N2P
Molecular Weight 340.29 g/mol
SMILES CCCCCCCCN1C=C[N+](=C1)C.F[P-](F)(F)(F)(F)F
InChIKey GRCIJNHHTXBJAK-UHFFFAOYSA-N
Last Updated: 2025-10-01 21:42

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3-Methyl-1-octyl-1H-imidazol-3-ium hexafluorophosphate (CAS: 304680-36-2)?

3-Methyl-1-octyl-1H-imidazol-3-ium hexafluorophosphate is a crystalline compound with a molecular we...

Compound Q&A

How is 3-Methyl-1-octyl-1H-imidazol-3-ium hexafluorophosphate (CAS: 304680-36-2) typically synthesized?

3-Methyl-1-octyl-1H-imidazol-3-ium hexafluorophosphate is synthesized through a multi-step process s...

Compound Q&A

What precautions should be taken when handling 3-Methyl-1-octyl-1H-imidazol-3-ium hexafluorophosphate (CAS: 304680-36-2)?

When handling 3-Methyl-1-octyl-1H-imidazol-3-ium hexafluorophosphate, it is essential to wear approp...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...