Compound Q&A

What industries use 2-Fluoro-6-nitroaniline (CAS: 17809-36-8)?

Answer

2-Fluoro-6-nitroaniline
2-Fluoro-6-nitroaniline finds applications in the pharmaceutical industry for the synthesis of certain drugs. It is also used in the production of dyes and pigments. Additionally, it can be used in the preparation of semiconductors and as a reagent in analytical chemistry and sensor technology.

About

CAS No 17809-36-8
English Name 2-Fluoro-6-nitroaniline
Molecular Formula C6H5FN2O2
Molecular Weight 156.11 g/mol
SMILES C1=CC(=C(C(=C1)F)N)[N+](=O)[O-]
InChIKey BHWHYGWMNMCXBA-UHFFFAOYSA-N
Last Updated: 2025-10-01 13:51

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Fluoro-6-nitroaniline (CAS: 17809-36-8)?

2-Fluoro-6-nitroaniline is a crystalline solid with a molecular weight of approximately 189.03 g/mol...

Compound Q&A

How is 2-Fluoro-6-nitroaniline (CAS: 17809-36-8) typically synthesized?

2-Fluoro-6-nitroaniline is typically synthesized by nitration of 2-fluoroaniline. The reaction invol...

Compound Q&A

What precautions should be taken when handling 2-Fluoro-6-nitroaniline (CAS: 17809-36-8)?

When handling 2-Fluoro-6-nitroaniline, it is essential to wear appropriate personal protective equip...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...