Compound Q&A

How is 2-Fluoro-6-nitroaniline (CAS: 17809-36-8) typically synthesized?

Answer

2-Fluoro-6-nitroaniline
2-Fluoro-6-nitroaniline is typically synthesized by nitration of 2-fluoroaniline. The reaction involves treating 2-fluoroaniline with a nitric acid/sulfuric acid mixture at temperatures around 50°C. This process is selective and yields a product with high purity. The reaction is usually conducted in a fume hood to handle the fumes produced.

About

CAS No 17809-36-8
English Name 2-Fluoro-6-nitroaniline
Molecular Formula C6H5FN2O2
Molecular Weight 156.11 g/mol
SMILES C1=CC(=C(C(=C1)F)N)[N+](=O)[O-]
InChIKey BHWHYGWMNMCXBA-UHFFFAOYSA-N
Last Updated: 2025-10-01 13:51

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Fluoro-6-nitroaniline (CAS: 17809-36-8)?

2-Fluoro-6-nitroaniline is a crystalline solid with a molecular weight of approximately 189.03 g/mol...

Compound Q&A

What industries use 2-Fluoro-6-nitroaniline (CAS: 17809-36-8)?

2-Fluoro-6-nitroaniline finds applications in the pharmaceutical industry for the synthesis of certa...

Compound Q&A

What precautions should be taken when handling 2-Fluoro-6-nitroaniline (CAS: 17809-36-8)?

When handling 2-Fluoro-6-nitroaniline, it is essential to wear appropriate personal protective equip...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...