Compound Q&A

How is 2-Fluoro-6-nitroaniline (CAS: 17809-36-8) typically synthesized?

Answer

2-Fluoro-6-nitroaniline
2-Fluoro-6-nitroaniline is typically synthesized by nitration of 2-fluoroaniline. The reaction involves treating 2-fluoroaniline with a nitric acid/sulfuric acid mixture at temperatures around 50°C. This process is selective and yields a product with high purity. The reaction is usually conducted in a fume hood to handle the fumes produced.

About

CAS No 17809-36-8
English Name 2-Fluoro-6-nitroaniline
Molecular Formula C6H5FN2O2
Molecular Weight 156.11 g/mol
SMILES C1=CC(=C(C(=C1)F)N)[N+](=O)[O-]
InChIKey BHWHYGWMNMCXBA-UHFFFAOYSA-N
Last Updated: 2025-10-01 13:51

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Fluoro-6-nitroaniline (CAS: 17809-36-8)?

2-Fluoro-6-nitroaniline is a crystalline solid with a molecular weight of approximately 189.03 g/mol...

Compound Q&A

What industries use 2-Fluoro-6-nitroaniline (CAS: 17809-36-8)?

2-Fluoro-6-nitroaniline finds applications in the pharmaceutical industry for the synthesis of certa...

Compound Q&A

What precautions should be taken when handling 2-Fluoro-6-nitroaniline (CAS: 17809-36-8)?

When handling 2-Fluoro-6-nitroaniline, it is essential to wear appropriate personal protective equip...

Compound Q&A

How should waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3) be handled?

Waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3...

898825-89-3N-Methoxy-N-methyl-1...
Compound Q&A

How should N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine (CAS: 1318338-47-4) be stored?

N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine should be stored in a tightly sealed c...

1318338-47-4N-(4-Biphenylyl)dibe...
Compound Q&A

What is the market or research trend for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1)?

The market for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1) is...

1713-07-13-Acetamido-5-amino-...
Compound Q&A

How should Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) be stored?

Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) ...

61820-03-9Benzyl 2-O-acetyl-3,...