Compound Q&A

What are the physical and chemical properties of 2-Fluoro-6-nitroaniline (CAS: 17809-36-8)?

Answer

2-Fluoro-6-nitroaniline
2-Fluoro-6-nitroaniline is a crystalline solid with a molecular weight of approximately 189.03 g/mol. It has a low solubility in water but is more soluble in common organic solvents such as ethanol and acetone. This compound is moderately reactive, especially under acidic or basic conditions. It is stable under normal conditions but can undergo hydrolysis and reduction under certain conditions.

About

CAS No 17809-36-8
English Name 2-Fluoro-6-nitroaniline
Molecular Formula C6H5FN2O2
Molecular Weight 156.11 g/mol
SMILES C1=CC(=C(C(=C1)F)N)[N+](=O)[O-]
InChIKey BHWHYGWMNMCXBA-UHFFFAOYSA-N
Last Updated: 2025-10-01 13:51

Related Q&A

Compound Q&A

How is 2-Fluoro-6-nitroaniline (CAS: 17809-36-8) typically synthesized?

2-Fluoro-6-nitroaniline is typically synthesized by nitration of 2-fluoroaniline. The reaction invol...

Compound Q&A

What industries use 2-Fluoro-6-nitroaniline (CAS: 17809-36-8)?

2-Fluoro-6-nitroaniline finds applications in the pharmaceutical industry for the synthesis of certa...

Compound Q&A

What precautions should be taken when handling 2-Fluoro-6-nitroaniline (CAS: 17809-36-8)?

When handling 2-Fluoro-6-nitroaniline, it is essential to wear appropriate personal protective equip...

Compound Q&A

How should waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3) be handled?

Waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3...

898825-89-3N-Methoxy-N-methyl-1...
Compound Q&A

How should N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine (CAS: 1318338-47-4) be stored?

N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine should be stored in a tightly sealed c...

1318338-47-4N-(4-Biphenylyl)dibe...
Compound Q&A

What is the market or research trend for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1)?

The market for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1) is...

1713-07-13-Acetamido-5-amino-...
Compound Q&A

How should Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) be stored?

Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) ...

61820-03-9Benzyl 2-O-acetyl-3,...