Compound Q&A

What industries use 1-Hexyl-3-methyl-1H-imidazol-3-ium bromide (CAS: 85100-78-3)?

Answer

1-Hexyl-3-methyl-1H-imidazol-3-ium bromide
1-Hexyl-3-methyl-1H-imidazol-3-ium bromide finds applications in industries such as pharmaceuticals, where it is used as a precursor in the synthesis of biologically active compounds. It is also utilized in polymer science for the modification of polymer properties, in sensor technology for the development of gas sensors, and in semiconductor manufacturing for certain etching processes.

About

CAS No 85100-78-3
English Name 1-Hexyl-3-methyl-1H-imidazol-3-ium bromide
Molecular Formula C10H19BrN2
Molecular Weight 247.18 g/mol
SMILES C[N+]1=CN(CCCCCC)C=C1.[Br-]
InChIKey BGSUDDILQRFOKZ-UHFFFAOYSA-M
Last Updated: 2025-10-01 13:51

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1-Hexyl-3-methyl-1H-imidazol-3-ium bromide (CAS: 85100-78-3)?

1-Hexyl-3-methyl-1H-imidazol-3-ium bromide is a solid with a crystalline form. The molecular weight ...

Compound Q&A

How is 1-Hexyl-3-methyl-1H-imidazol-3-ium bromide (CAS: 85100-78-3) typically synthesized?

1-Hexyl-3-methyl-1H-imidazol-3-ium bromide is typically synthesized by the reaction of 3-bromobenzim...

Compound Q&A

What precautions should be taken when handling 1-Hexyl-3-methyl-1H-imidazol-3-ium bromide (CAS: 85100-78-3)?

When handling 1-Hexyl-3-methyl-1H-imidazol-3-ium bromide, it is essential to wear appropriate person...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...