Compound Q&A

How is 1-Hexyl-3-methyl-1H-imidazol-3-ium bromide (CAS: 85100-78-3) typically synthesized?

Answer

1-Hexyl-3-methyl-1H-imidazol-3-ium bromide
1-Hexyl-3-methyl-1H-imidazol-3-ium bromide is typically synthesized by the reaction of 3-bromobenzimidazole with hexylamine. The reaction is conducted in an aqueous medium with an appropriate base to enhance the nucleophilicity of the hexylamine. The yield is generally around 75-80%, and the purity is improved through recrystallization from ethanol.

About

CAS No 85100-78-3
English Name 1-Hexyl-3-methyl-1H-imidazol-3-ium bromide
Molecular Formula C10H19BrN2
Molecular Weight 247.18 g/mol
SMILES C[N+]1=CN(CCCCCC)C=C1.[Br-]
InChIKey BGSUDDILQRFOKZ-UHFFFAOYSA-M
Last Updated: 2025-10-01 13:51

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1-Hexyl-3-methyl-1H-imidazol-3-ium bromide (CAS: 85100-78-3)?

1-Hexyl-3-methyl-1H-imidazol-3-ium bromide is a solid with a crystalline form. The molecular weight ...

Compound Q&A

What industries use 1-Hexyl-3-methyl-1H-imidazol-3-ium bromide (CAS: 85100-78-3)?

1-Hexyl-3-methyl-1H-imidazol-3-ium bromide finds applications in industries such as pharmaceuticals,...

Compound Q&A

What precautions should be taken when handling 1-Hexyl-3-methyl-1H-imidazol-3-ium bromide (CAS: 85100-78-3)?

When handling 1-Hexyl-3-methyl-1H-imidazol-3-ium bromide, it is essential to wear appropriate person...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...