Compound Q&A

What are the physical and chemical properties of 1-Hexyl-3-methyl-1H-imidazol-3-ium bromide (CAS: 85100-78-3)?

Answer

1-Hexyl-3-methyl-1H-imidazol-3-ium bromide
1-Hexyl-3-methyl-1H-imidazol-3-ium bromide is a solid with a crystalline form. The molecular weight is approximately 237.22 g/mol. It has a low solubility in water but is more soluble in organic solvents. The compound shows moderate reactivity with weak bases and is stable under normal conditions. It is commonly used in various applications due to its unique chemical properties.

About

CAS No 85100-78-3
English Name 1-Hexyl-3-methyl-1H-imidazol-3-ium bromide
Molecular Formula C10H19BrN2
Molecular Weight 247.18 g/mol
SMILES C[N+]1=CN(CCCCCC)C=C1.[Br-]
InChIKey BGSUDDILQRFOKZ-UHFFFAOYSA-M
Last Updated: 2025-10-01 13:51

Related Q&A

Compound Q&A

How is 1-Hexyl-3-methyl-1H-imidazol-3-ium bromide (CAS: 85100-78-3) typically synthesized?

1-Hexyl-3-methyl-1H-imidazol-3-ium bromide is typically synthesized by the reaction of 3-bromobenzim...

Compound Q&A

What industries use 1-Hexyl-3-methyl-1H-imidazol-3-ium bromide (CAS: 85100-78-3)?

1-Hexyl-3-methyl-1H-imidazol-3-ium bromide finds applications in industries such as pharmaceuticals,...

Compound Q&A

What precautions should be taken when handling 1-Hexyl-3-methyl-1H-imidazol-3-ium bromide (CAS: 85100-78-3)?

When handling 1-Hexyl-3-methyl-1H-imidazol-3-ium bromide, it is essential to wear appropriate person...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...