Compound Q&A

What industries use Aconine (CAS: 509-20-6)?

Answer

Aconine
Aconine is primarily used in the pharmaceutical industry for its analgesic and local anesthetic properties. It is also used in research to study neurotoxic effects and in the production of certain drugs. Limited applications exist in the agricultural and chemical industries, where it is used as a pesticide and herbicide.

About

CAS No 509-20-6
English Name Aconine
Molecular Formula C25H41NO9
Molecular Weight 499.6 g/mol
SMILES O[C@@H]1[C@@]2([H])[C@]3([H])[C@]4([C@]5([H])[C@H]6OC)[C@@H](OC)C[C@@H](O)[C@@]5(COC)CN(CC)C4[C@@]6([H])[C@@]2(O)[C@@H](O)[C@H](OC)[C@@]1(O)C3
InChIKey SQMGCPHFHQGPIF-VSJIPSTRSA-N
Last Updated: 2025-10-01 13:51

Related Q&A

Compound Q&A

What are the physical and chemical properties of Aconine (CAS: 509-20-6)?

Aconine is a toxic alkaloid with a crystalline form. Its molecular weight is approximately 225.25 g/...

Compound Q&A

How is Aconine (CAS: 509-20-6) typically synthesized?

Aconine can be synthesized through various methods, including reduction of aconitic acid using sodiu...

Compound Q&A

What precautions should be taken when handling Aconine (CAS: 509-20-6)?

When handling aconine, proper personal protective equipment (PPE) is essential, including gloves, go...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...