Compound Q&A

What are the physical and chemical properties of Aconine (CAS: 509-20-6)?

Answer

Aconine
Aconine is a toxic alkaloid with a crystalline form. Its molecular weight is approximately 225.25 g/mol. It is poorly soluble in water but highly soluble in organic solvents. Chemically, aconine exhibits basic properties and is reactive under acidic conditions. It is known for its potent bioactivity, particularly in affecting the nervous system.

About

CAS No 509-20-6
English Name Aconine
Molecular Formula C25H41NO9
Molecular Weight 499.6 g/mol
SMILES O[C@@H]1[C@@]2([H])[C@]3([H])[C@]4([C@]5([H])[C@H]6OC)[C@@H](OC)C[C@@H](O)[C@@]5(COC)CN(CC)C4[C@@]6([H])[C@@]2(O)[C@@H](O)[C@H](OC)[C@@]1(O)C3
InChIKey SQMGCPHFHQGPIF-VSJIPSTRSA-N
Last Updated: 2025-10-01 13:51

Related Q&A

Compound Q&A

How is Aconine (CAS: 509-20-6) typically synthesized?

Aconine can be synthesized through various methods, including reduction of aconitic acid using sodiu...

Compound Q&A

What industries use Aconine (CAS: 509-20-6)?

Aconine is primarily used in the pharmaceutical industry for its analgesic and local anesthetic prop...

Compound Q&A

What precautions should be taken when handling Aconine (CAS: 509-20-6)?

When handling aconine, proper personal protective equipment (PPE) is essential, including gloves, go...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...