Compound Q&A

How is Aconine (CAS: 509-20-6) typically synthesized?

Answer

Aconine
Aconine can be synthesized through various methods, including reduction of aconitic acid using sodium borohydride as a catalyst. The reaction typically yields 80-90% selectivity, although proper handling and purification are essential to achieve high purity. Other methods involve organic transformations from precursors like aconitine.

About

CAS No 509-20-6
English Name Aconine
Molecular Formula C25H41NO9
Molecular Weight 499.6 g/mol
SMILES O[C@@H]1[C@@]2([H])[C@]3([H])[C@]4([C@]5([H])[C@H]6OC)[C@@H](OC)C[C@@H](O)[C@@]5(COC)CN(CC)C4[C@@]6([H])[C@@]2(O)[C@@H](O)[C@H](OC)[C@@]1(O)C3
InChIKey SQMGCPHFHQGPIF-VSJIPSTRSA-N
Last Updated: 2025-10-01 13:51

Related Q&A

Compound Q&A

What are the physical and chemical properties of Aconine (CAS: 509-20-6)?

Aconine is a toxic alkaloid with a crystalline form. Its molecular weight is approximately 225.25 g/...

Compound Q&A

What industries use Aconine (CAS: 509-20-6)?

Aconine is primarily used in the pharmaceutical industry for its analgesic and local anesthetic prop...

Compound Q&A

What precautions should be taken when handling Aconine (CAS: 509-20-6)?

When handling aconine, proper personal protective equipment (PPE) is essential, including gloves, go...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...