Compound Q&A

What industries use 3-(Acryloylamino)-N,N,N-trimethyl-1-propanaminium chloride (CAS: 45021-77-0)?

Answer

3-(Acryloylamino)-N,N,N-trimethyl-1-propanaminium chloride
This compound is used in the pharmaceutical industry for the synthesis of certain drugs. It is also used in the polymer industry to modify polymer properties. Additionally, it has applications in the production of sensors and semiconductors due to its chemical reactivity and stability.

About

CAS No 45021-77-0
English Name 3-(Acryloylamino)-N,N,N-trimethyl-1-propanaminium chloride
Molecular Formula C9H19ClN2O
Molecular Weight 206.71 g/mol
SMILES C[N+](C)(CCCNC(C=C)=O)C.[Cl-]
InChIKey OEIXGLMQZVLOQX-UHFFFAOYSA-N
Last Updated: 2025-10-01 13:51

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3-(Acryloylamino)-N,N,N-trimethyl-1-propanaminium chloride (CAS: 45021-77-0)?

The compound is a crystalline solid with a molecular weight of approximately 232.34 g/mol. It has po...

Compound Q&A

How is 3-(Acryloylamino)-N,N,N-trimethyl-1-propanaminium chloride (CAS: 45021-77-0) typically synthesized?

The compound is usually synthesized by reacting acryloyl chloride with N,N,N-trimethyl-1-propanamine...

Compound Q&A

What precautions should be taken when handling 3-(Acryloylamino)-N,N,N-trimethyl-1-propanaminium chloride (CAS: 45021-77-0)?

When handling this compound, it is important to wear appropriate personal protective equipment (PPE)...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...