Compound Q&A

How is 3-(Acryloylamino)-N,N,N-trimethyl-1-propanaminium chloride (CAS: 45021-77-0) typically synthesized?

Answer

3-(Acryloylamino)-N,N,N-trimethyl-1-propanaminium chloride
The compound is usually synthesized by reacting acryloyl chloride with N,N,N-trimethyl-1-propanamine. The reaction is typically carried out in the presence of a catalyst such as pyridine at room temperature. The yield is generally high, and the product can be purified by recrystallization or distillation.

About

CAS No 45021-77-0
English Name 3-(Acryloylamino)-N,N,N-trimethyl-1-propanaminium chloride
Molecular Formula C9H19ClN2O
Molecular Weight 206.71 g/mol
SMILES C[N+](C)(CCCNC(C=C)=O)C.[Cl-]
InChIKey OEIXGLMQZVLOQX-UHFFFAOYSA-N
Last Updated: 2025-10-01 13:51

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3-(Acryloylamino)-N,N,N-trimethyl-1-propanaminium chloride (CAS: 45021-77-0)?

The compound is a crystalline solid with a molecular weight of approximately 232.34 g/mol. It has po...

Compound Q&A

What industries use 3-(Acryloylamino)-N,N,N-trimethyl-1-propanaminium chloride (CAS: 45021-77-0)?

This compound is used in the pharmaceutical industry for the synthesis of certain drugs. It is also ...

Compound Q&A

What precautions should be taken when handling 3-(Acryloylamino)-N,N,N-trimethyl-1-propanaminium chloride (CAS: 45021-77-0)?

When handling this compound, it is important to wear appropriate personal protective equipment (PPE)...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...