Compound Q&A

What precautions should be taken when handling 4-Bromobenzo[de]isochromene-1,3-dione (CAS: 21563-29-1)?

Answer

4-Bromobenzo[de]isochromene-1,3-dione
When handling 4-Bromobenzo[de]isochromene-1,3-dione, it is essential to wear appropriate personal protective equipment (PPE) such as gloves, goggles, and a lab coat. Work must be conducted in a well-ventilated area or a fume hood to minimize exposure to fumes. Spills should be cleaned up promptly with appropriate absorbents, and appropriate safety data sheets (SDS) should be consulted for detailed handling and disposal instructions.

About

CAS No 21563-29-1
English Name 4-Bromobenzo[de]isochromene-1,3-dione
Molecular Formula C12H5BrO3
Molecular Weight 277.07 g/mol
SMILES C1=CC2=C3C(=C1)C(=O)OC(=O)C3=C(C=C2)Br
InChIKey TZUREPOYENXNME-UHFFFAOYSA-N
Last Updated: 2025-10-01 13:51

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-Bromobenzo[de]isochromene-1,3-dione (CAS: 21563-29-1)?

4-Bromobenzo[de]isochromene-1,3-dione is a white crystalline solid with a molecular weight of approx...

Compound Q&A

How is 4-Bromobenzo[de]isochromene-1,3-dione (CAS: 21563-29-1) typically synthesized?

4-Bromobenzo[de]isochromene-1,3-dione can be synthesized through a multistep process involving bromi...

Compound Q&A

What industries use 4-Bromobenzo[de]isochromene-1,3-dione (CAS: 21563-29-1)?

4-Bromobenzo[de]isochromene-1,3-dione is primarily used in the pharmaceutical and organic semiconduc...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...