Compound Q&A

How is 4-Bromobenzo[de]isochromene-1,3-dione (CAS: 21563-29-1) typically synthesized?

Answer

4-Bromobenzo[de]isochromene-1,3-dione
4-Bromobenzo[de]isochromene-1,3-dione can be synthesized through a multistep process involving bromination of a chromene derivative, followed by isomerization and condensation steps. Common catalysts include Lewis acids, and the overall yield and selectivity can be improved by optimizing reaction conditions such as temperature and solvent choice.

About

CAS No 21563-29-1
English Name 4-Bromobenzo[de]isochromene-1,3-dione
Molecular Formula C12H5BrO3
Molecular Weight 277.07 g/mol
SMILES C1=CC2=C3C(=C1)C(=O)OC(=O)C3=C(C=C2)Br
InChIKey TZUREPOYENXNME-UHFFFAOYSA-N
Last Updated: 2025-10-01 13:51

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-Bromobenzo[de]isochromene-1,3-dione (CAS: 21563-29-1)?

4-Bromobenzo[de]isochromene-1,3-dione is a white crystalline solid with a molecular weight of approx...

Compound Q&A

What industries use 4-Bromobenzo[de]isochromene-1,3-dione (CAS: 21563-29-1)?

4-Bromobenzo[de]isochromene-1,3-dione is primarily used in the pharmaceutical and organic semiconduc...

Compound Q&A

What precautions should be taken when handling 4-Bromobenzo[de]isochromene-1,3-dione (CAS: 21563-29-1)?

When handling 4-Bromobenzo[de]isochromene-1,3-dione, it is essential to wear appropriate personal pr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...