Compound Q&A

What are the physical and chemical properties of 4-Bromobenzo[de]isochromene-1,3-dione (CAS: 21563-29-1)?

Answer

4-Bromobenzo[de]isochromene-1,3-dione
4-Bromobenzo[de]isochromene-1,3-dione is a white crystalline solid with a molecular weight of approximately 253.03 g/mol. It is slightly soluble in water but more soluble in organic solvents like ethanol and acetone. The compound is reactive towards nucleophiles and can undergo substitution reactions. It has a melting point of around 190-192°C and a density of about 1.47 g/cm³.

About

CAS No 21563-29-1
English Name 4-Bromobenzo[de]isochromene-1,3-dione
Molecular Formula C12H5BrO3
Molecular Weight 277.07 g/mol
SMILES C1=CC2=C3C(=C1)C(=O)OC(=O)C3=C(C=C2)Br
InChIKey TZUREPOYENXNME-UHFFFAOYSA-N
Last Updated: 2025-10-01 13:51

Related Q&A

Compound Q&A

How is 4-Bromobenzo[de]isochromene-1,3-dione (CAS: 21563-29-1) typically synthesized?

4-Bromobenzo[de]isochromene-1,3-dione can be synthesized through a multistep process involving bromi...

Compound Q&A

What industries use 4-Bromobenzo[de]isochromene-1,3-dione (CAS: 21563-29-1)?

4-Bromobenzo[de]isochromene-1,3-dione is primarily used in the pharmaceutical and organic semiconduc...

Compound Q&A

What precautions should be taken when handling 4-Bromobenzo[de]isochromene-1,3-dione (CAS: 21563-29-1)?

When handling 4-Bromobenzo[de]isochromene-1,3-dione, it is essential to wear appropriate personal pr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...