Compound Q&A

What industries use 7-Nitro-2H-indazole (CAS: 2942-42-9)?

Answer

7-Nitro-2H-indazole
7-Nitro-2H-indazole is primarily used in the pharmaceutical industry as an intermediate in the synthesis of various drugs. It also finds applications in the polymer industry for the development of functional polymers, in the semiconductor industry for organic electronic devices, and in the sensor industry for the fabrication of gas sensors.

About

CAS No 2942-42-9
English Name 7-Nitro-2H-indazole
Molecular Formula C7H5N3O2
Molecular Weight 163.13 g/mol
SMILES C1=CC2=C(C(=C1)[N+](=O)[O-])NN=C2
InChIKey PQCAUHUKTBHUSA-UHFFFAOYSA-N
Last Updated: 2025-10-01 13:51

Related Q&A

Compound Q&A

What are the physical and chemical properties of 7-Nitro-2H-indazole (CAS: 2942-42-9)?

7-Nitro-2H-indazole (CAS: 2942-42-9) is a yellow solid with a crystalline form. Its molecular weight...

Compound Q&A

How is 7-Nitro-2H-indazole (CAS: 2942-42-9) typically synthesized?

7-Nitro-2H-indazole is typically synthesized by nitration of 2H-indazole with concentrated nitric ac...

Compound Q&A

What precautions should be taken when handling 7-Nitro-2H-indazole (CAS: 2942-42-9)?

When handling 7-Nitro-2H-indazole (CAS: 2942-42-9), it is crucial to wear appropriate personal prote...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...