Compound Q&A

What are the physical and chemical properties of 7-Nitro-2H-indazole (CAS: 2942-42-9)?

Answer

7-Nitro-2H-indazole
7-Nitro-2H-indazole (CAS: 2942-42-9) is a yellow solid with a crystalline form. Its molecular weight is approximately 167.11 g/mol. It has a solubility of 1.5 mg/mL in water and is practically insoluble in organic solvents like ethanol and acetone. Chemically, it is relatively stable but can undergo nitration and reduction reactions. It is soluble in common organic solvents such as dichloromethane and acetonitrile.

About

CAS No 2942-42-9
English Name 7-Nitro-2H-indazole
Molecular Formula C7H5N3O2
Molecular Weight 163.13 g/mol
SMILES C1=CC2=C(C(=C1)[N+](=O)[O-])NN=C2
InChIKey PQCAUHUKTBHUSA-UHFFFAOYSA-N
Last Updated: 2025-10-01 13:51

Related Q&A

Compound Q&A

How is 7-Nitro-2H-indazole (CAS: 2942-42-9) typically synthesized?

7-Nitro-2H-indazole is typically synthesized by nitration of 2H-indazole with concentrated nitric ac...

Compound Q&A

What industries use 7-Nitro-2H-indazole (CAS: 2942-42-9)?

7-Nitro-2H-indazole is primarily used in the pharmaceutical industry as an intermediate in the synth...

Compound Q&A

What precautions should be taken when handling 7-Nitro-2H-indazole (CAS: 2942-42-9)?

When handling 7-Nitro-2H-indazole (CAS: 2942-42-9), it is crucial to wear appropriate personal prote...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...