Compound Q&A

How is 7-Nitro-2H-indazole (CAS: 2942-42-9) typically synthesized?

Answer

7-Nitro-2H-indazole
7-Nitro-2H-indazole is typically synthesized by nitration of 2H-indazole with concentrated nitric acid in the presence of a catalyst like sulfuric acid. The process requires careful temperature control to achieve high yield and selectivity. The overall yield is around 70-80%, and the reaction is exothermic, necessitating cooling to prevent decomposition.

About

CAS No 2942-42-9
English Name 7-Nitro-2H-indazole
Molecular Formula C7H5N3O2
Molecular Weight 163.13 g/mol
SMILES C1=CC2=C(C(=C1)[N+](=O)[O-])NN=C2
InChIKey PQCAUHUKTBHUSA-UHFFFAOYSA-N
Last Updated: 2025-10-01 13:51

Related Q&A

Compound Q&A

What are the physical and chemical properties of 7-Nitro-2H-indazole (CAS: 2942-42-9)?

7-Nitro-2H-indazole (CAS: 2942-42-9) is a yellow solid with a crystalline form. Its molecular weight...

Compound Q&A

What industries use 7-Nitro-2H-indazole (CAS: 2942-42-9)?

7-Nitro-2H-indazole is primarily used in the pharmaceutical industry as an intermediate in the synth...

Compound Q&A

What precautions should be taken when handling 7-Nitro-2H-indazole (CAS: 2942-42-9)?

When handling 7-Nitro-2H-indazole (CAS: 2942-42-9), it is crucial to wear appropriate personal prote...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...