Compound Q&A

What industries use Ethyl [2-(4-phenoxyphenoxy)ethyl]carbamate (CAS: 72490-01-8)?

Answer

Ethyl [2-(4-phenoxyphenoxy)ethyl]carbamate
Ethyl [2-(4-phenoxyphenoxy)ethyl]carbamate (CAS: 72490-01-8) is used in the pharmaceutical industry for the synthesis of certain active pharmaceutical ingredients. It also finds applications in the polymer industry as a monomer for the production of specific polymers with unique physicochemical properties. Additionally, it is used in the development of sensors and in the semiconductor industry for specific chemical processing steps.

About

CAS No 72490-01-8
English Name Ethyl [2-(4-phenoxyphenoxy)ethyl]carbamate
Molecular Formula C17H19NO4
Molecular Weight 301.34 g/mol
SMILES CCOC(=O)NCCOc1ccc(cc1)Oc2ccccc2
InChIKey HJUFTIJOISQSKQ-UHFFFAOYSA-N
Last Updated: 2025-10-01 13:51

Related Q&A

Compound Q&A

What are the physical and chemical properties of Ethyl [2-(4-phenoxyphenoxy)ethyl]carbamate (CAS: 72490-01-8)?

Ethyl [2-(4-phenoxyphenoxy)ethyl]carbamate (CAS: 72490-01-8) is a crystalline compound with a molecu...

Compound Q&A

How is Ethyl [2-(4-phenoxyphenoxy)ethyl]carbamate (CAS: 72490-01-8) typically synthesized?

Ethyl [2-(4-phenoxyphenoxy)ethyl]carbamate (CAS: 72490-01-8) is typically synthesized through a mult...

Compound Q&A

What precautions should be taken when handling Ethyl [2-(4-phenoxyphenoxy)ethyl]carbamate (CAS: 72490-01-8)?

When handling Ethyl [2-(4-phenoxyphenoxy)ethyl]carbamate (CAS: 72490-01-8), it is essential to use a...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...