Compound Q&A

What are the physical and chemical properties of Ethyl [2-(4-phenoxyphenoxy)ethyl]carbamate (CAS: 72490-01-8)?

Answer

Ethyl [2-(4-phenoxyphenoxy)ethyl]carbamate
Ethyl [2-(4-phenoxyphenoxy)ethyl]carbamate (CAS: 72490-01-8) is a crystalline compound with a molecular weight of approximately 350.31 g/mol. It has a low water solubility and is slightly soluble in common organic solvents such as ethanol and acetone. The compound is relatively stable under normal conditions but can hydrolyze in basic environments. It exhibits low reactivity in general chemical reactions.

About

CAS No 72490-01-8
English Name Ethyl [2-(4-phenoxyphenoxy)ethyl]carbamate
Molecular Formula C17H19NO4
Molecular Weight 301.34 g/mol
SMILES CCOC(=O)NCCOc1ccc(cc1)Oc2ccccc2
InChIKey HJUFTIJOISQSKQ-UHFFFAOYSA-N
Last Updated: 2025-10-01 13:51

Related Q&A

Compound Q&A

How is Ethyl [2-(4-phenoxyphenoxy)ethyl]carbamate (CAS: 72490-01-8) typically synthesized?

Ethyl [2-(4-phenoxyphenoxy)ethyl]carbamate (CAS: 72490-01-8) is typically synthesized through a mult...

Compound Q&A

What industries use Ethyl [2-(4-phenoxyphenoxy)ethyl]carbamate (CAS: 72490-01-8)?

Ethyl [2-(4-phenoxyphenoxy)ethyl]carbamate (CAS: 72490-01-8) is used in the pharmaceutical industry ...

Compound Q&A

What precautions should be taken when handling Ethyl [2-(4-phenoxyphenoxy)ethyl]carbamate (CAS: 72490-01-8)?

When handling Ethyl [2-(4-phenoxyphenoxy)ethyl]carbamate (CAS: 72490-01-8), it is essential to use a...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...