Compound Q&A

What industries use (17beta)-3-Oxoandrost-4-ene-17-carboxylic acid (CAS: 302-97-6)?

Answer

(17beta)-3-Oxoandrost-4-ene-17-carboxylic acid
(17beta)-3-Oxoandrost-4-ene-17-carboxylic acid is primarily used in the pharmaceutical industry for the synthesis of progestogens and other steroid hormones. It is also utilized in the sensor technology sector for developing highly sensitive detection systems due to its specific reactivity with certain biological molecules. Additionally, it plays a role in polymer science for the production of certain types of biodegradable polymers.

About

CAS No 302-97-6
English Name (17beta)-3-Oxoandrost-4-ene-17-carboxylic acid
Molecular Formula C20H28O3
Molecular Weight 316.44 g/mol
SMILES CC12CCC3C(C1CCC2C(=O)O)CCC4=CC(=O)CCC34C
InChIKey YQACAXHKQZCEOI-UDCWSGSHSA-N
Last Updated: 2025-10-01 13:51

Related Q&A

Compound Q&A

What are the physical and chemical properties of (17beta)-3-Oxoandrost-4-ene-17-carboxylic acid (CAS: 302-97-6)?

(17beta)-3-Oxoandrost-4-ene-17-carboxylic acid is a crystalline solid with a molecular weight of app...

Compound Q&A

How is (17beta)-3-Oxoandrost-4-ene-17-carboxylic acid (CAS: 302-97-6) typically synthesized?

(17beta)-3-Oxoandrost-4-ene-17-carboxylic acid can be synthesized through the reduction of androst-4...

Compound Q&A

What precautions should be taken when handling (17beta)-3-Oxoandrost-4-ene-17-carboxylic acid (CAS: 302-97-6)?

When handling (17beta)-3-Oxoandrost-4-ene-17-carboxylic acid, it is crucial to wear appropriate pers...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...