Compound Q&A

How is (17beta)-3-Oxoandrost-4-ene-17-carboxylic acid (CAS: 302-97-6) typically synthesized?

Answer

(17beta)-3-Oxoandrost-4-ene-17-carboxylic acid
(17beta)-3-Oxoandrost-4-ene-17-carboxylic acid can be synthesized through the reduction of androst-4-ene-17-one followed by carboxylation. Commonly, this involves the use of lithium aluminum hydride (LAH) for reduction and then the addition of carbon dioxide in the presence of a base to introduce the carboxylic acid functionality. The reaction is typically carried out under anhydrous conditions to prevent side reactions.

About

CAS No 302-97-6
English Name (17beta)-3-Oxoandrost-4-ene-17-carboxylic acid
Molecular Formula C20H28O3
Molecular Weight 316.44 g/mol
SMILES CC12CCC3C(C1CCC2C(=O)O)CCC4=CC(=O)CCC34C
InChIKey YQACAXHKQZCEOI-UDCWSGSHSA-N
Last Updated: 2025-10-01 13:51

Related Q&A

Compound Q&A

What are the physical and chemical properties of (17beta)-3-Oxoandrost-4-ene-17-carboxylic acid (CAS: 302-97-6)?

(17beta)-3-Oxoandrost-4-ene-17-carboxylic acid is a crystalline solid with a molecular weight of app...

Compound Q&A

What industries use (17beta)-3-Oxoandrost-4-ene-17-carboxylic acid (CAS: 302-97-6)?

(17beta)-3-Oxoandrost-4-ene-17-carboxylic acid is primarily used in the pharmaceutical industry for ...

Compound Q&A

What precautions should be taken when handling (17beta)-3-Oxoandrost-4-ene-17-carboxylic acid (CAS: 302-97-6)?

When handling (17beta)-3-Oxoandrost-4-ene-17-carboxylic acid, it is crucial to wear appropriate pers...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...