Compound Q&A

What precautions should be taken when handling 3-Iodophthalic acid (CAS: 6937-34-4)?

Answer

3-Iodophthalic acid
When handling 3-Iodophthalic acid (CAS: 6937-34-4), it is essential to wear appropriate personal protective equipment (PPE), including gloves, goggles, and a lab coat. Ensure the use of a fume hood to minimize exposure to vapors. Store the compound in a cool, dry place, away from heat and moisture. In case of spills, immediately clean up using appropriate absorbent materials and follow the safety data sheet (SDS) guidelines for disposal.

About

CAS No 6937-34-4
English Name 3-Iodophthalic acid
Molecular Formula C8H5IO4
Molecular Weight 292.03 g/mol
SMILES C1=CC(=C(C(=C1)I)C(=O)O)C(=O)O
InChIKey HNPVERUJGFNNRV-UHFFFAOYSA-N
Last Updated: 2025-10-01 13:51

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3-Iodophthalic acid (CAS: 6937-34-4)?

3-Iodophthalic acid (CAS: 6937-34-4) is a crystalline compound with a molecular weight of approximat...

Compound Q&A

How is 3-Iodophthalic acid (CAS: 6937-34-4) typically synthesized?

3-Iodophthalic acid is typically synthesized by the iodination of phthalic anhydride using iodine an...

Compound Q&A

What industries use 3-Iodophthalic acid (CAS: 6937-34-4)?

3-Iodophthalic acid (CAS: 6937-34-4) is used in various industries, including pharmaceuticals, where...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...