Compound Q&A

How is 3-Iodophthalic acid (CAS: 6937-34-4) typically synthesized?

Answer

3-Iodophthalic acid
3-Iodophthalic acid is typically synthesized by the iodination of phthalic anhydride using iodine and a phase transfer catalyst. The iodination process is selective and yields high purity product. The reaction is conducted in a solvent such as acetonitrile or dioxane under reflux conditions, followed by recrystallization to obtain the desired crystalline form.

About

CAS No 6937-34-4
English Name 3-Iodophthalic acid
Molecular Formula C8H5IO4
Molecular Weight 292.03 g/mol
SMILES C1=CC(=C(C(=C1)I)C(=O)O)C(=O)O
InChIKey HNPVERUJGFNNRV-UHFFFAOYSA-N
Last Updated: 2025-10-01 13:51

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3-Iodophthalic acid (CAS: 6937-34-4)?

3-Iodophthalic acid (CAS: 6937-34-4) is a crystalline compound with a molecular weight of approximat...

Compound Q&A

What industries use 3-Iodophthalic acid (CAS: 6937-34-4)?

3-Iodophthalic acid (CAS: 6937-34-4) is used in various industries, including pharmaceuticals, where...

Compound Q&A

What precautions should be taken when handling 3-Iodophthalic acid (CAS: 6937-34-4)?

When handling 3-Iodophthalic acid (CAS: 6937-34-4), it is essential to wear appropriate personal pro...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...