Compound Q&A

What are the physical and chemical properties of 3-Iodophthalic acid (CAS: 6937-34-4)?

Answer

3-Iodophthalic acid
3-Iodophthalic acid (CAS: 6937-34-4) is a crystalline compound with a molecular weight of approximately 285.20 g/mol. It has a pKa of about 4.7, indicating a weak acid. The compound is soluble in water and ethanol. It exhibits limited reactivity and is stable under normal conditions but should be protected from moisture and heat to prevent degradation.

About

CAS No 6937-34-4
English Name 3-Iodophthalic acid
Molecular Formula C8H5IO4
Molecular Weight 292.03 g/mol
SMILES C1=CC(=C(C(=C1)I)C(=O)O)C(=O)O
InChIKey HNPVERUJGFNNRV-UHFFFAOYSA-N
Last Updated: 2025-10-01 13:51

Related Q&A

Compound Q&A

How is 3-Iodophthalic acid (CAS: 6937-34-4) typically synthesized?

3-Iodophthalic acid is typically synthesized by the iodination of phthalic anhydride using iodine an...

Compound Q&A

What industries use 3-Iodophthalic acid (CAS: 6937-34-4)?

3-Iodophthalic acid (CAS: 6937-34-4) is used in various industries, including pharmaceuticals, where...

Compound Q&A

What precautions should be taken when handling 3-Iodophthalic acid (CAS: 6937-34-4)?

When handling 3-Iodophthalic acid (CAS: 6937-34-4), it is essential to wear appropriate personal pro...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...