Compound Q&A

What industries use 1-Fluoro-4-nitro-2-(trifluoromethyl)benzene (CAS: 400-74-8)?

Answer

1-Fluoro-4-nitro-2-(trifluoromethyl)benzene
1-Fluoro-4-nitro-2-(trifluoromethyl)benzene is used in the pharmaceutical industry for the synthesis of certain drugs. It is also utilized in the polymer industry for the production of special polymers with enhanced properties. Additionally, it finds applications in the semiconductor industry as a precursor for the production of electronic materials and in the chemical sensors industry for developing gas-sensing devices.

About

CAS No 400-74-8
English Name 1-Fluoro-4-nitro-2-(trifluoromethyl)benzene
Molecular Formula C7H3F4NO2
Molecular Weight 209.1 g/mol
SMILES C1=CC(=C(C=C1[N+](=O)[O-])C(F)(F)F)F
InChIKey DNTHMWUMRGOJRY-UHFFFAOYSA-N
Last Updated: 2025-10-01 13:51

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1-Fluoro-4-nitro-2-(trifluoromethyl)benzene (CAS: 400-74-8)?

1-Fluoro-4-nitro-2-(trifluoromethyl)benzene is a crystalline solid with a molecular weight of approx...

Compound Q&A

How is 1-Fluoro-4-nitro-2-(trifluoromethyl)benzene (CAS: 400-74-8) typically synthesized?

1-Fluoro-4-nitro-2-(trifluoromethyl)benzene is typically synthesized by the nitration of 1-fluoro-2-...

Compound Q&A

What precautions should be taken when handling 1-Fluoro-4-nitro-2-(trifluoromethyl)benzene (CAS: 400-74-8)?

When handling 1-Fluoro-4-nitro-2-(trifluoromethyl)benzene, it is essential to wear appropriate perso...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...