Compound Q&A

How is 1-Fluoro-4-nitro-2-(trifluoromethyl)benzene (CAS: 400-74-8) typically synthesized?

Answer

1-Fluoro-4-nitro-2-(trifluoromethyl)benzene
1-Fluoro-4-nitro-2-(trifluoromethyl)benzene is typically synthesized by the nitration of 1-fluoro-2-(trifluoromethyl)benzene using a mixture of nitric and sulfuric acids. The reaction is carried out in a solvent like acetic acid at a temperature around 50°C. The product is then purified by recrystallization from a suitable solvent to obtain the crystalline form.

About

CAS No 400-74-8
English Name 1-Fluoro-4-nitro-2-(trifluoromethyl)benzene
Molecular Formula C7H3F4NO2
Molecular Weight 209.1 g/mol
SMILES C1=CC(=C(C=C1[N+](=O)[O-])C(F)(F)F)F
InChIKey DNTHMWUMRGOJRY-UHFFFAOYSA-N
Last Updated: 2025-10-01 13:51

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1-Fluoro-4-nitro-2-(trifluoromethyl)benzene (CAS: 400-74-8)?

1-Fluoro-4-nitro-2-(trifluoromethyl)benzene is a crystalline solid with a molecular weight of approx...

Compound Q&A

What industries use 1-Fluoro-4-nitro-2-(trifluoromethyl)benzene (CAS: 400-74-8)?

1-Fluoro-4-nitro-2-(trifluoromethyl)benzene is used in the pharmaceutical industry for the synthesis...

Compound Q&A

What precautions should be taken when handling 1-Fluoro-4-nitro-2-(trifluoromethyl)benzene (CAS: 400-74-8)?

When handling 1-Fluoro-4-nitro-2-(trifluoromethyl)benzene, it is essential to wear appropriate perso...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...