Compound Q&A

What are the physical and chemical properties of 1-Fluoro-4-nitro-2-(trifluoromethyl)benzene (CAS: 400-74-8)?

Answer

1-Fluoro-4-nitro-2-(trifluoromethyl)benzene
1-Fluoro-4-nitro-2-(trifluoromethyl)benzene is a crystalline solid with a molecular weight of approximately 261.04 g/mol. It has a melting point of 108-109°C and is only slightly soluble in water but soluble in common organic solvents like ethanol and acetone. The compound is highly reactive due to the presence of the nitro and trifluoromethyl groups, which make it a strong electrophile in chemical reactions.

About

CAS No 400-74-8
English Name 1-Fluoro-4-nitro-2-(trifluoromethyl)benzene
Molecular Formula C7H3F4NO2
Molecular Weight 209.1 g/mol
SMILES C1=CC(=C(C=C1[N+](=O)[O-])C(F)(F)F)F
InChIKey DNTHMWUMRGOJRY-UHFFFAOYSA-N
Last Updated: 2025-10-01 13:51

Related Q&A

Compound Q&A

How is 1-Fluoro-4-nitro-2-(trifluoromethyl)benzene (CAS: 400-74-8) typically synthesized?

1-Fluoro-4-nitro-2-(trifluoromethyl)benzene is typically synthesized by the nitration of 1-fluoro-2-...

Compound Q&A

What industries use 1-Fluoro-4-nitro-2-(trifluoromethyl)benzene (CAS: 400-74-8)?

1-Fluoro-4-nitro-2-(trifluoromethyl)benzene is used in the pharmaceutical industry for the synthesis...

Compound Q&A

What precautions should be taken when handling 1-Fluoro-4-nitro-2-(trifluoromethyl)benzene (CAS: 400-74-8)?

When handling 1-Fluoro-4-nitro-2-(trifluoromethyl)benzene, it is essential to wear appropriate perso...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...